C8H6OS — CID 11137339
(1R,7S)-10-oxa-4-thiatricyclo[5.2.1.02,6]deca-2,5,8-triene (PubChem CID 11137339) has the molecular formula C8H6OS and a molecular weight of 150.20 g/mol. Its IUPAC name is (1R,7S)-10-oxa-4-thiatricyclo[5.2.1.02,6]deca-2,5,8-triene.
| Compound Name | (1R,7S)-10-oxa-4-thiatricyclo[5.2.1.02,6]deca-2,5,8-triene |
|---|---|
| PubChem CID | 11137339 |
| Molecular Formula | C8H6OS |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | (1R,7S)-10-oxa-4-thiatricyclo[5.2.1.02,6]deca-2,5,8-triene |
| SMILES | C1=C[C@H]2O[C@@H]1c1cscc12 |
| InChI | InChI=1S/C8H6OS/c1-2-8-6-4-10-3-5(6)7(1)9-8/h1-4,7-8H/t7-,8+ |
| InChIKey | RDOBMVJRLDXUAZ-OCAPTIKFSA-N |
| XLogP | 2.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|