C19H26IN3O2S — CID 111373816
1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111373816) has the molecular formula C19H26IN3O2S and a molecular weight of 487.41 g/mol. Its IUPAC name is 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111373816 |
| Molecular Formula | C19H26IN3O2S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)NCCSc1ccccc1.I |
| InChI | InChI=1S/C19H25N3O2S.HI/c1-3-20-19(21-12-13-25-16-9-5-4-6-10-16)22-14-15-8-7-11-17(24-2)18(15)23;/h4-11,23H,3,12-14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | OZMGSRZMMUTNCJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|