C8H13NO2 — CID 11137384
(1R,8S)-1-methoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 11137384) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (1R,8S)-1-methoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1R,8S)-1-methoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 11137384 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (1R,8S)-1-methoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CO[C@@H]1CC(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C8H13NO2/c1-11-7-5-8(10)9-4-2-3-6(7)9/h6-7H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | RKVWCHREQIFPNG-NKWVEPMBSA-N |
| XLogP | 0.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |