About 5-propan-2-yl-1,3-thiazole-4-carbaldehyde
5-propan-2-yl-1,3-thiazole-4-carbaldehyde (PubChem CID 11137386) has the molecular formula C7H9NOS
and a molecular weight of 155.22 g/mol. Its IUPAC name is 5-propan-2-yl-1,3-thiazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-propan-2-yl-1,3-thiazole-4-carbaldehyde |
| PubChem CID | 11137386 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 5-propan-2-yl-1,3-thiazole-4-carbaldehyde |
| SMILES | CC(C)c1scnc1C=O |
| InChI | InChI=1S/C7H9NOS/c1-5(2)7-6(3-9)8-4-10-7/h3-5H,1-2H3 |
| InChIKey | ZNCIEQFZRKIVOL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-propan-2-yl-1,3-thiazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,3-thiazole-4-carbaldehyde?
The IUPAC name of 5-propan-2-yl-1,3-thiazole-4-carbaldehyde (CID 11137386) is 5-propan-2-yl-1,3-thiazole-4-carbaldehyde.
What is the SMILES notation for 5-propan-2-yl-1,3-thiazole-4-carbaldehyde?
The canonical SMILES for 5-propan-2-yl-1,3-thiazole-4-carbaldehyde is CC(C)c1scnc1C=O.
What is the InChIKey of 5-propan-2-yl-1,3-thiazole-4-carbaldehyde?
The InChIKey is ZNCIEQFZRKIVOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NOS/c1-5(2)7-6(3-9)8-4-10-7/h3-5H,1-2H3.
What are the key properties of 5-propan-2-yl-1,3-thiazole-4-carbaldehyde?
5-propan-2-yl-1,3-thiazole-4-carbaldehyde has a molecular weight of 155.22 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,3-thiazole-4-carbaldehyde is sourced from PubChem (CID 11137386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).