C23H30FN5O2 — CID 111374347
2-[[N-ethyl-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 111374347) has the molecular formula C23H30FN5O2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[N-ethyl-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111374347 |
| Molecular Formula | C23H30FN5O2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 2-[[N-ethyl-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCOCC1)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H30FN5O2/c1-2-25-23(27-16-22(30)28-21-9-7-20(24)8-10-21)26-15-18-5-3-4-6-19(18)17-29-11-13-31-14-12-29/h3-10H,2,11-17H2,1H3,(H,28,30)(H2,25,26,27) |
| InChIKey | RPQOFCLBEFIURN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|