C22H29N5O2 — CID 111374395
4-[[[N'-methyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111374395) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-[[[N'-methyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | 4-[[[N'-methyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111374395 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 4-[[[N'-methyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1ccc(C(N)=O)cc1)NCc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C22H29N5O2/c1-24-22(25-14-17-6-8-18(9-7-17)21(23)28)26-15-19-4-2-3-5-20(19)16-27-10-12-29-13-11-27/h2-9H,10-16H2,1H3,(H2,23,28)(H2,24,25,26) |
| InChIKey | OUXHPKDZTPTXKS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|