C25H36IN5O2 — CID 111374654
N-[2-[[N-ethyl-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-3-methylbenzamide;hydroiodide (PubChem CID 111374654) has the molecular formula C25H36IN5O2 and a molecular weight of 565.50 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-3-methylbenzamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-3-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111374654 |
| Molecular Formula | C25H36IN5O2 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-3-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCOCC1)NCCNC(=O)c1cccc(C)c1.I |
| InChI | InChI=1S/C25H35N5O2.HI/c1-3-26-25(28-12-11-27-24(31)21-10-6-7-20(2)17-21)29-18-22-8-4-5-9-23(22)19-30-13-15-32-16-14-30;/h4-10,17H,3,11-16,18-19H2,1-2H3,(H,27,31)(H2,26,28,29);1H |
| InChIKey | DVYAKXKZMWWFTH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|