About 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile
2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile (PubChem CID 11137485) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile |
| PubChem CID | 11137485 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile |
| SMILES | Cc1cn(CC#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H7N3O2/c1-5-4-10(3-2-8)7(12)9-6(5)11/h4H,3H2,1H3,(H,9,11,12) |
| InChIKey | UMVKCMBKTCDASG-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile?
The IUPAC name of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile (CID 11137485) is 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile.
What is the SMILES notation for 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile?
The canonical SMILES for 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile is Cc1cn(CC#N)c(=O)[nH]c1=O.
What is the InChIKey of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile?
The InChIKey is UMVKCMBKTCDASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-5-4-10(3-2-8)7(12)9-6(5)11/h4H,3H2,1H3,(H,9,11,12).
What are the key properties of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile?
2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile has a molecular weight of 165.15 g/mol, XLogP of -0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetonitrile is sourced from PubChem (CID 11137485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).