About 1-bromoethyl acetate
1-bromoethyl acetate (PubChem CID 11137505) has the molecular formula C4H7BrO2
and a molecular weight of 167.00 g/mol. Its IUPAC name is 1-bromoethyl acetate.
Molecular Properties
| Compound Name | 1-bromoethyl acetate |
| PubChem CID | 11137505 |
| Molecular Formula | C4H7BrO2 |
| Molecular Weight | 167.00 g/mol |
| Exact Mass | 165.96 |
| IUPAC Name | 1-bromoethyl acetate |
| SMILES | CC(=O)OC(C)Br |
| InChI | InChI=1S/C4H7BrO2/c1-3(5)7-4(2)6/h3H,1-2H3 |
| InChIKey | IIASCQBFNHWZBE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.00 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoethyl acetate?
The IUPAC name of 1-bromoethyl acetate (CID 11137505) is 1-bromoethyl acetate.
What is the SMILES notation for 1-bromoethyl acetate?
The canonical SMILES for 1-bromoethyl acetate is CC(=O)OC(C)Br.
What is the InChIKey of 1-bromoethyl acetate?
The InChIKey is IIASCQBFNHWZBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7BrO2/c1-3(5)7-4(2)6/h3H,1-2H3.
What are the key properties of 1-bromoethyl acetate?
1-bromoethyl acetate has a molecular weight of 167.00 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoethyl acetate is sourced from PubChem (CID 11137505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).