C26H39N5O — CID 111375145
1-[2-(dimethylamino)-3-phenylpropyl]-3-ethyl-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111375145) has the molecular formula C26H39N5O and a molecular weight of 437.63 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-3-phenylpropyl]-3-ethyl-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(dimethylamino)-3-phenylpropyl]-3-ethyl-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111375145 |
| Molecular Formula | C26H39N5O |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.32 |
| IUPAC Name | 1-[2-(dimethylamino)-3-phenylpropyl]-3-ethyl-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCOCC1)NCC(Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C26H39N5O/c1-4-27-26(29-20-25(30(2)3)18-22-10-6-5-7-11-22)28-19-23-12-8-9-13-24(23)21-31-14-16-32-17-15-31/h5-13,25H,4,14-21H2,1-3H3,(H2,27,28,29) |
| InChIKey | PWHWOBCPCONODA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|