methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate

C8H11NO3 — CID 11137540

IUPACmethyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate
SMILESCOC(=O)N1C=CC(=O)CC1C
InChIInChI=1S/C8H11NO3/c1-6-5-7(10)3-4-9(6)8(11)12-2/h3-4,6H,5H2,1-2H3
InChIKeyCGNWWJIYIOIVFM-UHFFFAOYSA-N
MW169.18 g/mol
LogP0.93
Rot. Bonds

About methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate

methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 11137540) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate.

Molecular Properties

Compound Namemethyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate
PubChem CID11137540
Molecular FormulaC8H11NO3
Molecular Weight169.18 g/mol
Exact Mass169.07
IUPAC Namemethyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate
SMILESCOC(=O)N1C=CC(=O)CC1C
InChIInChI=1S/C8H11NO3/c1-6-5-7(10)3-4-9(6)8(11)12-2/h3-4,6H,5H2,1-2H3
InChIKeyCGNWWJIYIOIVFM-UHFFFAOYSA-N
XLogP0.93
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.18
LogP ≤ 50.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate?
The IUPAC name of methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate (CID 11137540) is methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate.
What is the SMILES notation for methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate?
The canonical SMILES for methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate is COC(=O)N1C=CC(=O)CC1C.
What is the InChIKey of methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate?
The InChIKey is CGNWWJIYIOIVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-6-5-7(10)3-4-9(6)8(11)12-2/h3-4,6H,5H2,1-2H3.
What are the key properties of methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate?
methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate has a molecular weight of 169.18 g/mol, XLogP of 0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate is sourced from PubChem (CID 11137540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).