About (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol
(E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol (PubChem CID 11137560) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol.
Molecular Properties
| Compound Name | (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol |
| PubChem CID | 11137560 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol |
| SMILES | CCC/C(=C\[C@H](C)O)[C@@H]1O[C@H]1C |
| InChI | InChI=1S/C10H18O2/c1-4-5-9(6-7(2)11)10-8(3)12-10/h6-8,10-11H,4-5H2,1-3H3/b9-6+/t7-,8-,10+/m0/s1 |
| InChIKey | XARUSBRNZIIJCG-HKOJIXPYSA-N |
| XLogP | 1.88 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol?
The IUPAC name of (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol (CID 11137560) is (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol.
What is the SMILES notation for (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol?
The canonical SMILES for (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol is CCC/C(=C\[C@H](C)O)[C@@H]1O[C@H]1C.
What is the InChIKey of (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol?
The InChIKey is XARUSBRNZIIJCG-HKOJIXPYSA-N. The full InChI is InChI=1S/C10H18O2/c1-4-5-9(6-7(2)11)10-8(3)12-10/h6-8,10-11H,4-5H2,1-3H3/b9-6+/t7-,8-,10+/m0/s1.
What are the key properties of (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol?
(E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol has a molecular weight of 170.25 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-4-[(2S,3S)-3-methyloxiran-2-yl]hept-3-en-2-ol is sourced from PubChem (CID 11137560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).