C8H14O4 — CID 11137613
ethyl (E,4R,5R)-4,5-dihydroxyhex-2-enoate (PubChem CID 11137613) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is ethyl (E,4R,5R)-4,5-dihydroxyhex-2-enoate.
| Compound Name | ethyl (E,4R,5R)-4,5-dihydroxyhex-2-enoate |
|---|---|
| PubChem CID | 11137613 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | ethyl (E,4R,5R)-4,5-dihydroxyhex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C8H14O4/c1-3-12-8(11)5-4-7(10)6(2)9/h4-7,9-10H,3H2,1-2H3/b5-4+/t6-,7-/m1/s1 |
| InChIKey | XDXGQILMSPBVGA-XIMOZBJHSA-N |
| XLogP | -0.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|