C6H6Cl2N2 — CID 11137668
4,5-dichloro-6-ethylpyrimidine (PubChem CID 11137668) has the molecular formula C6H6Cl2N2 and a molecular weight of 177.03 g/mol. Its IUPAC name is 4,5-dichloro-6-ethylpyrimidine.
| Compound Name | 4,5-dichloro-6-ethylpyrimidine |
|---|---|
| PubChem CID | 11137668 |
| Molecular Formula | C6H6Cl2N2 |
| Molecular Weight | 177.03 g/mol |
| Exact Mass | 175.99 |
| IUPAC Name | 4,5-dichloro-6-ethylpyrimidine |
| SMILES | CCc1ncnc(Cl)c1Cl |
| InChI | InChI=1S/C6H6Cl2N2/c1-2-4-5(7)6(8)10-3-9-4/h3H,2H2,1H3 |
| InChIKey | RPVZESOQOOPTGU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.03 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |