C12H18O — CID 11137695
3-[(1S,2R,4R)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]propanal (PubChem CID 11137695) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 3-[(1S,2R,4R)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]propanal.
| Compound Name | 3-[(1S,2R,4R)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]propanal |
|---|---|
| PubChem CID | 11137695 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 3-[(1S,2R,4R)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]propanal |
| SMILES | C=C1[C@@H]2CC[C@@H](C2)[C@@]1(C)CCC=O |
| InChI | InChI=1S/C12H18O/c1-9-10-4-5-11(8-10)12(9,2)6-3-7-13/h7,10-11H,1,3-6,8H2,2H3/t10-,11+,12+/m1/s1 |
| InChIKey | LWTMDKBJLLLBBC-WOPDTQHZSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|