C8H12O3 — CID 11137713
2-[(1R,2S)-1,2-dideuterio-2-(hydroxymethyl)cyclopent-3-en-1-yl]acetic acid (PubChem CID 11137713) has the molecular formula C8H12O3 and a molecular weight of 158.19 g/mol. Its IUPAC name is 2-[(1R,2S)-1,2-dideuterio-2-(hydroxymethyl)cyclopent-3-en-1-yl]acetic acid.
| Compound Name | 2-[(1R,2S)-1,2-dideuterio-2-(hydroxymethyl)cyclopent-3-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 11137713 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-[(1R,2S)-1,2-dideuterio-2-(hydroxymethyl)cyclopent-3-en-1-yl]acetic acid |
| SMILES | [2H][C@]1(CC(=O)O)CC=C[C@@]1([2H])CO |
| InChI | InChI=1S/C8H12O3/c9-5-7-3-1-2-6(7)4-8(10)11/h1,3,6-7,9H,2,4-5H2,(H,10,11)/t6-,7+/m1/s1/i6D,7D |
| InChIKey | GYZLELXIQDELFA-JNFTVNFHSA-N |
| XLogP | 0.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|