C22H29IN4O3 — CID 111377312
1-ethyl-3-(1H-indol-2-ylmethyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111377312) has the molecular formula C22H29IN4O3 and a molecular weight of 524.40 g/mol. Its IUPAC name is 1-ethyl-3-(1H-indol-2-ylmethyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(1H-indol-2-ylmethyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111377312 |
| Molecular Formula | C22H29IN4O3 |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 1-ethyl-3-(1H-indol-2-ylmethyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCc1cc2ccccc2[nH]1.I |
| InChI | InChI=1S/C22H28N4O3.HI/c1-5-23-22(25-14-17-12-16-8-6-7-9-18(16)26-17)24-13-15-10-19(27-2)21(29-4)20(11-15)28-3;/h6-12,26H,5,13-14H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | KGMCFBUTADVYHN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|