C24H34N4O4 — CID 111377433
1-[(2-cyclopentyloxy-4-pyridinyl)methyl]-3-ethyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111377433) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxy-4-pyridinyl)methyl]-3-ethyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[(2-cyclopentyloxy-4-pyridinyl)methyl]-3-ethyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111377433 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 1-[(2-cyclopentyloxy-4-pyridinyl)methyl]-3-ethyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCc1ccnc(OC2CCCC2)c1 |
| InChI | InChI=1S/C24H34N4O4/c1-5-25-24(28-16-18-12-20(29-2)23(31-4)21(13-18)30-3)27-15-17-10-11-26-22(14-17)32-19-8-6-7-9-19/h10-14,19H,5-9,15-16H2,1-4H3,(H2,25,27,28) |
| InChIKey | RAINUTZFISNTPM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|