About 2-phenyl-1,3,2-dioxaphosphinane
2-phenyl-1,3,2-dioxaphosphinane (PubChem CID 11137748) has the molecular formula C9H11O2P
and a molecular weight of 182.16 g/mol. Its IUPAC name is 2-phenyl-1,3,2-dioxaphosphinane.
Molecular Properties
| Compound Name | 2-phenyl-1,3,2-dioxaphosphinane |
| PubChem CID | 11137748 |
| Molecular Formula | C9H11O2P |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 2-phenyl-1,3,2-dioxaphosphinane |
| SMILES | c1ccc(P2OCCCO2)cc1 |
| InChI | InChI=1S/C9H11O2P/c1-2-5-9(6-3-1)12-10-7-4-8-11-12/h1-3,5-6H,4,7-8H2 |
| InChIKey | RPGJXPCHLNAQIC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-1,3,2-dioxaphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3,2-dioxaphosphinane?
The IUPAC name of 2-phenyl-1,3,2-dioxaphosphinane (CID 11137748) is 2-phenyl-1,3,2-dioxaphosphinane.
What is the SMILES notation for 2-phenyl-1,3,2-dioxaphosphinane?
The canonical SMILES for 2-phenyl-1,3,2-dioxaphosphinane is c1ccc(P2OCCCO2)cc1.
What is the InChIKey of 2-phenyl-1,3,2-dioxaphosphinane?
The InChIKey is RPGJXPCHLNAQIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O2P/c1-2-5-9(6-3-1)12-10-7-4-8-11-12/h1-3,5-6H,4,7-8H2.
What are the key properties of 2-phenyl-1,3,2-dioxaphosphinane?
2-phenyl-1,3,2-dioxaphosphinane has a molecular weight of 182.16 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3,2-dioxaphosphinane is sourced from PubChem (CID 11137748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).