C9H15NO3 — CID 11137821
1-[(2S)-1-hydroxy-3-methylbutan-2-yl]pyrrolidine-2,5-dione (PubChem CID 11137821) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxy-3-methylbutan-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(2S)-1-hydroxy-3-methylbutan-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11137821 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 1-[(2S)-1-hydroxy-3-methylbutan-2-yl]pyrrolidine-2,5-dione |
| SMILES | CC(C)[C@@H](CO)N1C(=O)CCC1=O |
| InChI | InChI=1S/C9H15NO3/c1-6(2)7(5-11)10-8(12)3-4-9(10)13/h6-7,11H,3-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | XLYKDNOTDMGWRA-SSDOTTSWSA-N |
| XLogP | 0.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|