About benzyl N-prop-2-ynylcarbamate
benzyl N-prop-2-ynylcarbamate (PubChem CID 11137906) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is benzyl N-prop-2-ynylcarbamate.
Molecular Properties
| Compound Name | benzyl N-prop-2-ynylcarbamate |
| PubChem CID | 11137906 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | benzyl N-prop-2-ynylcarbamate |
| SMILES | C#CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H11NO2/c1-2-8-12-11(13)14-9-10-6-4-3-5-7-10/h1,3-7H,8-9H2,(H,12,13) |
| InChIKey | SVBHWCDDVMKYTN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-prop-2-ynylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-prop-2-ynylcarbamate?
The IUPAC name of benzyl N-prop-2-ynylcarbamate (CID 11137906) is benzyl N-prop-2-ynylcarbamate.
What is the SMILES notation for benzyl N-prop-2-ynylcarbamate?
The canonical SMILES for benzyl N-prop-2-ynylcarbamate is C#CCNC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-prop-2-ynylcarbamate?
The InChIKey is SVBHWCDDVMKYTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-2-8-12-11(13)14-9-10-6-4-3-5-7-10/h1,3-7H,8-9H2,(H,12,13).
What are the key properties of benzyl N-prop-2-ynylcarbamate?
benzyl N-prop-2-ynylcarbamate has a molecular weight of 189.21 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-prop-2-ynylcarbamate is sourced from PubChem (CID 11137906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).