About 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one
9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one (PubChem CID 11137909) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one.
Molecular Properties
| Compound Name | 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one |
| PubChem CID | 11137909 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one |
| SMILES | O=C1c2ccccc2C2(O)CCCN12 |
| InChI | InChI=1S/C11H11NO2/c13-10-8-4-1-2-5-9(8)11(14)6-3-7-12(10)11/h1-2,4-5,14H,3,6-7H2 |
| InChIKey | AEEWRCLMCFNCEL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one?
The IUPAC name of 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one (CID 11137909) is 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one.
What is the SMILES notation for 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one?
The canonical SMILES for 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one is O=C1c2ccccc2C2(O)CCCN12.
What is the InChIKey of 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one?
The InChIKey is AEEWRCLMCFNCEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c13-10-8-4-1-2-5-9(8)11(14)6-3-7-12(10)11/h1-2,4-5,14H,3,6-7H2.
What are the key properties of 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one?
9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one has a molecular weight of 189.21 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9b-hydroxy-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one is sourced from PubChem (CID 11137909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).