C13H19N — CID 11137917
(3R,5R)-2,2,5-trimethyl-3-phenylpyrrolidine (PubChem CID 11137917) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (3R,5R)-2,2,5-trimethyl-3-phenylpyrrolidine.
| Compound Name | (3R,5R)-2,2,5-trimethyl-3-phenylpyrrolidine |
|---|---|
| PubChem CID | 11137917 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (3R,5R)-2,2,5-trimethyl-3-phenylpyrrolidine |
| SMILES | C[C@@H]1C[C@H](c2ccccc2)C(C)(C)N1 |
| InChI | InChI=1S/C13H19N/c1-10-9-12(13(2,3)14-10)11-7-5-4-6-8-11/h4-8,10,12,14H,9H2,1-3H3/t10-,12-/m1/s1 |
| InChIKey | FVDMLCGIOKMSRT-ZYHUDNBSSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |