C12H16O2 — CID 11137980
(1R,8R)-8-methoxytricyclo[6.2.1.01,5]undec-5-en-7-one (PubChem CID 11137980) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1R,8R)-8-methoxytricyclo[6.2.1.01,5]undec-5-en-7-one.
| Compound Name | (1R,8R)-8-methoxytricyclo[6.2.1.01,5]undec-5-en-7-one |
|---|---|
| PubChem CID | 11137980 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1R,8R)-8-methoxytricyclo[6.2.1.01,5]undec-5-en-7-one |
| SMILES | CO[C@@]12CC[C@]3(CCCC3=CC1=O)C2 |
| InChI | InChI=1S/C12H16O2/c1-14-12-6-5-11(8-12)4-2-3-9(11)7-10(12)13/h7H,2-6,8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | FYYPVMPZYMBTAY-VXGBXAGGSA-N |
| XLogP | 2.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |