About benzene-1,3,5-tricarboxylic acid
benzene-1,3,5-tricarboxylic acid (PubChem CID 11138) has the molecular formula C9H6O6
and a molecular weight of 210.14 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid.
Molecular Properties
| Compound Name | benzene-1,3,5-tricarboxylic acid |
| PubChem CID | 11138 |
| Molecular Formula | C9H6O6 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | QMKYBPDZANOJGF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene-1,3,5-tricarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3,5-tricarboxylic acid?
The IUPAC name of benzene-1,3,5-tricarboxylic acid (CID 11138) is benzene-1,3,5-tricarboxylic acid.
What is the SMILES notation for benzene-1,3,5-tricarboxylic acid?
The canonical SMILES for benzene-1,3,5-tricarboxylic acid is O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1.
What is the InChIKey of benzene-1,3,5-tricarboxylic acid?
The InChIKey is QMKYBPDZANOJGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15).
What are the key properties of benzene-1,3,5-tricarboxylic acid?
benzene-1,3,5-tricarboxylic acid has a molecular weight of 210.14 g/mol, XLogP of 0.78, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3,5-tricarboxylic acid is sourced from PubChem (CID 11138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).