C23H28N4O3 — CID 111380177
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]guanidine (PubChem CID 111380177) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111380177 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCO2)NCc1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-24-23(25-12-11-17-7-10-20-21(14-17)30-16-29-20)26-15-18-5-8-19(9-6-18)27-13-3-2-4-22(27)28/h5-10,14H,2-4,11-13,15-16H2,1H3,(H2,24,25,26) |
| InChIKey | XESDAVAWRGMLHN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|