C23H29FN4O3 — CID 111380620
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine (PubChem CID 111380620) has the molecular formula C23H29FN4O3 and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111380620 |
| Molecular Formula | C23H29FN4O3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCO2)NCC(c1cccc(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C23H29FN4O3/c1-25-23(26-8-7-17-5-6-21-22(13-17)31-16-30-21)27-15-20(28-9-11-29-12-10-28)18-3-2-4-19(24)14-18/h2-6,13-14,20H,7-12,15-16H2,1H3,(H2,25,26,27) |
| InChIKey | TVMFRANFQJZZQP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|