About 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one
4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one (PubChem CID 11138071) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one |
| PubChem CID | 11138071 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one |
| SMILES | COC1=CC(=O)C(C)=CC1(OC)OC |
| InChI | InChI=1S/C10H14O4/c1-7-6-10(13-3,14-4)9(12-2)5-8(7)11/h5-6H,1-4H3 |
| InChIKey | SDVUMCAZCQNBMM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one?
The IUPAC name of 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one (CID 11138071) is 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one is COC1=CC(=O)C(C)=CC1(OC)OC.
What is the InChIKey of 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one?
The InChIKey is SDVUMCAZCQNBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-7-6-10(13-3,14-4)9(12-2)5-8(7)11/h5-6H,1-4H3.
What are the key properties of 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one?
4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one has a molecular weight of 198.22 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,5-trimethoxy-2-methylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 11138071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).