C12H22O2 — CID 11138086
(E,3S)-7-methoxy-3,7-dimethyl-2-methylideneoct-5-en-1-ol (PubChem CID 11138086) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (E,3S)-7-methoxy-3,7-dimethyl-2-methylideneoct-5-en-1-ol.
| Compound Name | (E,3S)-7-methoxy-3,7-dimethyl-2-methylideneoct-5-en-1-ol |
|---|---|
| PubChem CID | 11138086 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (E,3S)-7-methoxy-3,7-dimethyl-2-methylideneoct-5-en-1-ol |
| SMILES | C=C(CO)[C@@H](C)C/C=C/C(C)(C)OC |
| InChI | InChI=1S/C12H22O2/c1-10(11(2)9-13)7-6-8-12(3,4)14-5/h6,8,10,13H,2,7,9H2,1,3-5H3/b8-6+/t10-/m0/s1 |
| InChIKey | HNOOGPRVZJKMCI-PCGIRMHASA-N |
| XLogP | 2.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|