C10H16O4 — CID 11138102
(3S,4S,5R)-3-acetyl-5-ethoxy-3,4-dimethyloxolan-2-one (PubChem CID 11138102) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (3S,4S,5R)-3-acetyl-5-ethoxy-3,4-dimethyloxolan-2-one.
| Compound Name | (3S,4S,5R)-3-acetyl-5-ethoxy-3,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 11138102 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (3S,4S,5R)-3-acetyl-5-ethoxy-3,4-dimethyloxolan-2-one |
| SMILES | CCO[C@@H]1OC(=O)[C@](C)(C(C)=O)[C@@H]1C |
| InChI | InChI=1S/C10H16O4/c1-5-13-8-6(2)10(4,7(3)11)9(12)14-8/h6,8H,5H2,1-4H3/t6-,8-,10+/m1/s1 |
| InChIKey | ABNYWYXJKSMNKE-YNEQXMIYSA-N |
| XLogP | 1.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|