C24H41N5O2 — CID 111381249
2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]guanidine (PubChem CID 111381249) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is 2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111381249 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | 2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc2c(cc1OCC)CC(C)O2)NCC(C)N1CCN(CC)CC1 |
| InChI | InChI=1S/C24H41N5O2/c1-6-25-24(26-16-18(4)29-11-9-28(7-2)10-12-29)27-17-21-15-23-20(13-19(5)31-23)14-22(21)30-8-3/h14-15,18-19H,6-13,16-17H2,1-5H3,(H2,25,26,27) |
| InChIKey | GFAPWSOLJZCPOC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|