C18H30N2O2 — CID 111381460
3-[[1-[(2-ethoxyphenyl)methyl]piperidin-4-yl]-methylamino]propan-1-ol (PubChem CID 111381460) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-[[1-[(2-ethoxyphenyl)methyl]piperidin-4-yl]-methylamino]propan-1-ol.
| Compound Name | 3-[[1-[(2-ethoxyphenyl)methyl]piperidin-4-yl]-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 111381460 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 3-[[1-[(2-ethoxyphenyl)methyl]piperidin-4-yl]-methylamino]propan-1-ol |
| SMILES | CCOc1ccccc1CN1CCC(N(C)CCCO)CC1 |
| InChI | InChI=1S/C18H30N2O2/c1-3-22-18-8-5-4-7-16(18)15-20-12-9-17(10-13-20)19(2)11-6-14-21/h4-5,7-8,17,21H,3,6,9-15H2,1-2H3 |
| InChIKey | IBGIYBLWTMCPSE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |