C12H14N2O — CID 11138151
6-methoxy-1,3,4,5-tetrahydrobenzo[cd]indol-4-amine (PubChem CID 11138151) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 6-methoxy-1,3,4,5-tetrahydrobenzo[cd]indol-4-amine.
| Compound Name | 6-methoxy-1,3,4,5-tetrahydrobenzo[cd]indol-4-amine |
|---|---|
| PubChem CID | 11138151 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 6-methoxy-1,3,4,5-tetrahydrobenzo[cd]indol-4-amine |
| SMILES | COc1ccc2[nH]cc3c2c1CC(N)C3 |
| InChI | InChI=1S/C12H14N2O/c1-15-11-3-2-10-12-7(6-14-10)4-8(13)5-9(11)12/h2-3,6,8,14H,4-5,13H2,1H3 |
| InChIKey | AEEIAUSQJMVCMW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |