C8H12Cl2Si — CID 11138272
1,1-dichloro-2,3,4,5-tetramethylsilole (PubChem CID 11138272) has the molecular formula C8H12Cl2Si and a molecular weight of 207.18 g/mol. Its IUPAC name is 1,1-dichloro-2,3,4,5-tetramethylsilole.
| Compound Name | 1,1-dichloro-2,3,4,5-tetramethylsilole |
|---|---|
| PubChem CID | 11138272 |
| Molecular Formula | C8H12Cl2Si |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 1,1-dichloro-2,3,4,5-tetramethylsilole |
| SMILES | CC1=C(C)[Si](Cl)(Cl)C(C)=C1C |
| InChI | InChI=1S/C8H12Cl2Si/c1-5-6(2)8(4)11(9,10)7(5)3/h1-4H3 |
| InChIKey | CHEFGIJZUFDNMJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|