C18H35N5O2 — CID 111383460
N-tert-butyl-2-[[ethylamino-[[3-(2-methylpiperidin-1-yl)-3-oxopropyl]amino]methylidene]amino]acetamide (PubChem CID 111383460) has the molecular formula C18H35N5O2 and a molecular weight of 353.51 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[[3-(2-methylpiperidin-1-yl)-3-oxopropyl]amino]methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[[3-(2-methylpiperidin-1-yl)-3-oxopropyl]amino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111383460 |
| Molecular Formula | C18H35N5O2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[[3-(2-methylpiperidin-1-yl)-3-oxopropyl]amino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCC(=O)N1CCCCC1C |
| InChI | InChI=1S/C18H35N5O2/c1-6-19-17(21-13-15(24)22-18(3,4)5)20-11-10-16(25)23-12-8-7-9-14(23)2/h14H,6-13H2,1-5H3,(H,22,24)(H2,19,20,21) |
| InChIKey | HPDZSVRKXSPGMJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|