C18H28N6O — CID 111384145
2-[[N-[3-(1H-benzimidazol-2-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide (PubChem CID 111384145) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[[N-[3-(1H-benzimidazol-2-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide.
| Compound Name | 2-[[N-[3-(1H-benzimidazol-2-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 111384145 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 2-[[N-[3-(1H-benzimidazol-2-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2[nH]1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H28N6O/c1-18(2,3)24-16(25)12-21-17(19-4)20-11-7-10-15-22-13-8-5-6-9-14(13)23-15/h5-6,8-9H,7,10-12H2,1-4H3,(H,22,23)(H,24,25)(H2,19,20,21) |
| InChIKey | YKBCTNIXFFAMAZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|