C23H39N5O — CID 111384547
N-tert-butyl-2-[[N-[[2-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111384547) has the molecular formula C23H39N5O and a molecular weight of 401.60 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[[2-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-[[2-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111384547 |
| Molecular Formula | C23H39N5O |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.32 |
| IUPAC Name | N-tert-butyl-2-[[N-[[2-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1ccccc1CN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C23H39N5O/c1-17-11-18(2)15-28(14-17)16-20-10-8-7-9-19(20)12-25-22(24-6)26-13-21(29)27-23(3,4)5/h7-10,17-18H,11-16H2,1-6H3,(H,27,29)(H2,24,25,26) |
| InChIKey | CTGGDMACQMJIEI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|