C14H28F3N5O — CID 111384611
N-tert-butyl-2-[[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]acetamide (PubChem CID 111384611) has the molecular formula C14H28F3N5O and a molecular weight of 339.41 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111384611 |
| Molecular Formula | C14H28F3N5O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H28F3N5O/c1-13(2,3)21-11(23)9-20-12(18-4)19-7-6-8-22(5)10-14(15,16)17/h6-10H2,1-5H3,(H,21,23)(H2,18,19,20) |
| InChIKey | XAIDVFHKWMDVOW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|