About CID 11138473
CID 11138473 (PubChem CID 11138473) has the molecular formula C6H8N
and a molecular weight of 94.14 g/mol.
Molecular Properties
| Compound Name | CID 11138473 |
| PubChem CID | 11138473 |
| Molecular Formula | C6H8N |
| Molecular Weight | 94.14 g/mol |
| Exact Mass | 94.07 |
| IUPAC Name | — |
| SMILES | C[C]1C=CC(C)=N1 |
| InChI | InChI=1S/C6H8N/c1-5-3-4-6(2)7-5/h3-4H,1-2H3 |
| InChIKey | IKWJKXMMTRXCDI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.14 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 11138473 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11138473?
The IUPAC name of CID 11138473 (CID 11138473) is not available.
What is the SMILES notation for CID 11138473?
The canonical SMILES for CID 11138473 is C[C]1C=CC(C)=N1.
What is the InChIKey of CID 11138473?
The InChIKey is IKWJKXMMTRXCDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N/c1-5-3-4-6(2)7-5/h3-4H,1-2H3.
What are the key properties of CID 11138473?
CID 11138473 has a molecular weight of 94.14 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11138473 is sourced from PubChem (CID 11138473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).