C15H28N6O — CID 111384827
N-tert-butyl-2-[[N'-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]acetamide (PubChem CID 111384827) has the molecular formula C15H28N6O and a molecular weight of 308.43 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111384827 |
| Molecular Formula | C15H28N6O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCCc1cnn(C)c1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H28N6O/c1-15(2,3)20-13(22)10-18-14(16-4)17-8-6-7-12-9-19-21(5)11-12/h9,11H,6-8,10H2,1-5H3,(H,20,22)(H2,16,17,18) |
| InChIKey | XGOKHTMLVKRJHV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|