About 9-ethoxy-9-oxononanoic acid
9-ethoxy-9-oxononanoic acid (PubChem CID 11138510) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 9-ethoxy-9-oxononanoic acid.
Molecular Properties
| Compound Name | 9-ethoxy-9-oxononanoic acid |
| PubChem CID | 11138510 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 9-ethoxy-9-oxononanoic acid |
| SMILES | CCOC(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C11H20O4/c1-2-15-11(14)9-7-5-3-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
| InChIKey | MTRYLAXNDGUFAK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-ethoxy-9-oxononanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethoxy-9-oxononanoic acid?
The IUPAC name of 9-ethoxy-9-oxononanoic acid (CID 11138510) is 9-ethoxy-9-oxononanoic acid.
What is the SMILES notation for 9-ethoxy-9-oxononanoic acid?
The canonical SMILES for 9-ethoxy-9-oxononanoic acid is CCOC(=O)CCCCCCCC(=O)O.
What is the InChIKey of 9-ethoxy-9-oxononanoic acid?
The InChIKey is MTRYLAXNDGUFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-2-15-11(14)9-7-5-3-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13).
What are the key properties of 9-ethoxy-9-oxononanoic acid?
9-ethoxy-9-oxononanoic acid has a molecular weight of 216.28 g/mol, XLogP of 2.36, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethoxy-9-oxononanoic acid is sourced from PubChem (CID 11138510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).