C12H24O3 — CID 11138520
methyl (2R,3R)-3-hydroxy-2-(3-methylbutyl)hexanoate (PubChem CID 11138520) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is methyl (2R,3R)-3-hydroxy-2-(3-methylbutyl)hexanoate.
| Compound Name | methyl (2R,3R)-3-hydroxy-2-(3-methylbutyl)hexanoate |
|---|---|
| PubChem CID | 11138520 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | methyl (2R,3R)-3-hydroxy-2-(3-methylbutyl)hexanoate |
| SMILES | CCC[C@@H](O)[C@@H](CCC(C)C)C(=O)OC |
| InChI | InChI=1S/C12H24O3/c1-5-6-11(13)10(12(14)15-4)8-7-9(2)3/h9-11,13H,5-8H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | ZSJDYYTUBDTDAG-GHMZBOCLSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |