About N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide
N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide (PubChem CID 11138618) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide.
Molecular Properties
| Compound Name | N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide |
| PubChem CID | 11138618 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide |
| SMILES | CC1(C)C[C@H](NC(=O)c2ccccc2)CO1 |
| InChI | InChI=1S/C13H17NO2/c1-13(2)8-11(9-16-13)14-12(15)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | CBHBOPACCJCNJH-NSHDSACASA-N |
| XLogP | 1.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide?
The IUPAC name of N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide (CID 11138618) is N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide.
What is the SMILES notation for N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide?
The canonical SMILES for N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide is CC1(C)C[C@H](NC(=O)c2ccccc2)CO1.
What is the InChIKey of N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide?
The InChIKey is CBHBOPACCJCNJH-NSHDSACASA-N. The full InChI is InChI=1S/C13H17NO2/c1-13(2)8-11(9-16-13)14-12(15)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3,(H,14,15)/t11-/m0/s1.
What are the key properties of N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide?
N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide has a molecular weight of 219.28 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-5,5-dimethyloxolan-3-yl]benzamide is sourced from PubChem (CID 11138618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).