C13H16O3 — CID 11138640
ethyl (1R,2S,6R,7S,10R)-10-hydroxytricyclo[5.2.1.02,6]deca-3,8-diene-8-carboxylate (PubChem CID 11138640) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is ethyl (1R,2S,6R,7S,10R)-10-hydroxytricyclo[5.2.1.02,6]deca-3,8-diene-8-carboxylate.
| Compound Name | ethyl (1R,2S,6R,7S,10R)-10-hydroxytricyclo[5.2.1.02,6]deca-3,8-diene-8-carboxylate |
|---|---|
| PubChem CID | 11138640 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethyl (1R,2S,6R,7S,10R)-10-hydroxytricyclo[5.2.1.02,6]deca-3,8-diene-8-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H]2[C@@H](O)[C@H]1[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C13H16O3/c1-2-16-13(15)10-6-9-7-4-3-5-8(7)11(10)12(9)14/h3-4,6-9,11-12,14H,2,5H2,1H3/t7-,8+,9-,11-,12+/m0/s1 |
| InChIKey | JBXCMZDDGXVYKS-SRHMGVCXSA-N |
| XLogP | 1.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|