C12H14O4 — CID 11138700
2,3-dimethoxy-9-methylidenespiro[4.4]non-2-ene-4,8-dione (PubChem CID 11138700) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,3-dimethoxy-9-methylidenespiro[4.4]non-2-ene-4,8-dione.
| Compound Name | 2,3-dimethoxy-9-methylidenespiro[4.4]non-2-ene-4,8-dione |
|---|---|
| PubChem CID | 11138700 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2,3-dimethoxy-9-methylidenespiro[4.4]non-2-ene-4,8-dione |
| SMILES | C=C1C(=O)CCC12CC(OC)=C(OC)C2=O |
| InChI | InChI=1S/C12H14O4/c1-7-8(13)4-5-12(7)6-9(15-2)10(16-3)11(12)14/h1,4-6H2,2-3H3 |
| InChIKey | BJUONPHPXRWJIU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|