About 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole
1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole (PubChem CID 11138747) has the molecular formula C11H13NO2S
and a molecular weight of 223.30 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
| PubChem CID | 11138747 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=CC2)cc1 |
| InChI | InChI=1S/C11H13NO2S/c1-10-4-6-11(7-5-10)15(13,14)12-8-2-3-9-12/h2-7H,8-9H2,1H3 |
| InChIKey | UNYMIBRUQCUASP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole?
The IUPAC name of 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole (CID 11138747) is 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole.
What is the SMILES notation for 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole?
The canonical SMILES for 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole is Cc1ccc(S(=O)(=O)N2CC=CC2)cc1.
What is the InChIKey of 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole?
The InChIKey is UNYMIBRUQCUASP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S/c1-10-4-6-11(7-5-10)15(13,14)12-8-2-3-9-12/h2-7H,8-9H2,1H3.
What are the key properties of 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole?
1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole has a molecular weight of 223.30 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole is sourced from PubChem (CID 11138747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).