C24H43N7 — CID 111388118
1-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111388118) has the molecular formula C24H43N7 and a molecular weight of 429.66 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111388118 |
| Molecular Formula | C24H43N7 |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | 1-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(CC)CC2)nc1)NCCCN1CCC(C)CC1 |
| InChI | InChI=1S/C24H43N7/c1-4-25-24(26-11-6-12-30-13-9-21(3)10-14-30)28-20-22-7-8-23(27-19-22)31-17-15-29(5-2)16-18-31/h7-8,19,21H,4-6,9-18,20H2,1-3H3,(H2,25,26,28) |
| InChIKey | PKMDLZPJUCCBGX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|