C14H27NO — CID 11138813
4-but-3-enyl-1,2,2,6,6-pentamethylpiperidin-4-ol (PubChem CID 11138813) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 4-but-3-enyl-1,2,2,6,6-pentamethylpiperidin-4-ol.
| Compound Name | 4-but-3-enyl-1,2,2,6,6-pentamethylpiperidin-4-ol |
|---|---|
| PubChem CID | 11138813 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 4-but-3-enyl-1,2,2,6,6-pentamethylpiperidin-4-ol |
| SMILES | C=CCCC1(O)CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C14H27NO/c1-7-8-9-14(16)10-12(2,3)15(6)13(4,5)11-14/h7,16H,1,8-11H2,2-6H3 |
| InChIKey | SAXPOUJTSOMGMM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|