C16H23N5O — CID 111388354
1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111388354) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111388354 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCc1cc(C)ccc1OC)NCc1ccn[nH]1 |
| InChI | InChI=1S/C16H23N5O/c1-12-4-5-15(22-3)13(10-12)6-8-18-16(17-2)19-11-14-7-9-20-21-14/h4-5,7,9-10H,6,8,11H2,1-3H3,(H,20,21)(H2,17,18,19) |
| InChIKey | ZFYHXYBVIRSSHO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|