C20H31N5O2 — CID 111388392
1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 111388392) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111388392 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCc1nc(C(C)C)no1)NCCc1cc(C)ccc1OC |
| InChI | InChI=1S/C20H31N5O2/c1-14(2)19-24-18(27-25-19)7-6-11-22-20(21-4)23-12-10-16-13-15(3)8-9-17(16)26-5/h8-9,13-14H,6-7,10-12H2,1-5H3,(H2,21,22,23) |
| InChIKey | FYLWZMXPUKLHIP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|